C15H17Cl2FN2O2S — CID 2969096
4-[2-[(2-chloro-6-fluorophenyl)methylamino]ethyl]benzenesulfonamide;hydrochloride (PubChem CID 2969096) has the molecular formula C15H17Cl2FN2O2S and a molecular weight of 379.28 g/mol. Its IUPAC name is 4-[2-[(2-chloro-6-fluorophenyl)methylamino]ethyl]benzenesulfonamide;hydrochloride.
| Compound Name | 4-[2-[(2-chloro-6-fluorophenyl)methylamino]ethyl]benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 2969096 |
| Molecular Formula | C15H17Cl2FN2O2S |
| Molecular Weight | 379.28 g/mol |
| Exact Mass | 378.04 |
| IUPAC Name | 4-[2-[(2-chloro-6-fluorophenyl)methylamino]ethyl]benzenesulfonamide;hydrochloride |
| SMILES | Cl.NS(=O)(=O)c1ccc(CCNCc2c(F)cccc2Cl)cc1 |
| InChI | InChI=1S/C15H16ClFN2O2S.ClH/c16-14-2-1-3-15(17)13(14)10-19-9-8-11-4-6-12(7-5-11)22(18,20)21;/h1-7,19H,8-10H2,(H2,18,20,21);1H |
| InChIKey | UQAIBVYITSYMQE-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.28 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|