C22H24ClFN2O3S — CID 17292932
4-[2-[[3-[(4-fluorophenyl)methoxy]phenyl]methylamino]ethyl]benzenesulfonamide;hydrochloride (PubChem CID 17292932) has the molecular formula C22H24ClFN2O3S and a molecular weight of 450.96 g/mol. Its IUPAC name is 4-[2-[[3-[(4-fluorophenyl)methoxy]phenyl]methylamino]ethyl]benzenesulfonamide;hydrochloride.
| Compound Name | 4-[2-[[3-[(4-fluorophenyl)methoxy]phenyl]methylamino]ethyl]benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 17292932 |
| Molecular Formula | C22H24ClFN2O3S |
| Molecular Weight | 450.96 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | 4-[2-[[3-[(4-fluorophenyl)methoxy]phenyl]methylamino]ethyl]benzenesulfonamide;hydrochloride |
| SMILES | Cl.NS(=O)(=O)c1ccc(CCNCc2cccc(OCc3ccc(F)cc3)c2)cc1 |
| InChI | InChI=1S/C22H23FN2O3S.ClH/c23-20-8-4-18(5-9-20)16-28-21-3-1-2-19(14-21)15-25-13-12-17-6-10-22(11-7-17)29(24,26)27;/h1-11,14,25H,12-13,15-16H2,(H2,24,26,27);1H |
| InChIKey | HNCMQNUUPDZMSN-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.96 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|