C27H35Cl2N3O3S — CID 139963149
4-[2-[[3-[3-(2-pyrrolidin-1-ylethoxy)phenyl]phenyl]methylamino]ethyl]benzenesulfonamide;dihydrochloride (PubChem CID 139963149) has the molecular formula C27H35Cl2N3O3S and a molecular weight of 552.57 g/mol. Its IUPAC name is 4-[2-[[3-[3-(2-pyrrolidin-1-ylethoxy)phenyl]phenyl]methylamino]ethyl]benzenesulfonamide;dihydrochloride.
| Compound Name | 4-[2-[[3-[3-(2-pyrrolidin-1-ylethoxy)phenyl]phenyl]methylamino]ethyl]benzenesulfonamide;dihydrochloride |
|---|---|
| PubChem CID | 139963149 |
| Molecular Formula | C27H35Cl2N3O3S |
| Molecular Weight | 552.57 g/mol |
| Exact Mass | 551.18 |
| IUPAC Name | 4-[2-[[3-[3-(2-pyrrolidin-1-ylethoxy)phenyl]phenyl]methylamino]ethyl]benzenesulfonamide;dihydrochloride |
| SMILES | Cl.Cl.NS(=O)(=O)c1ccc(CCNCc2cccc(-c3cccc(OCCN4CCCC4)c3)c2)cc1 |
| InChI | InChI=1S/C27H33N3O3S.2ClH/c28-34(31,32)27-11-9-22(10-12-27)13-14-29-21-23-5-3-6-24(19-23)25-7-4-8-26(20-25)33-18-17-30-15-1-2-16-30;;/h3-12,19-20,29H,1-2,13-18,21H2,(H2,28,31,32);2*1H |
| InChIKey | PYQWQMTWVJVLPP-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.57 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|