C29H38Cl2N4O3S — CID 139963174
N-(2-pyrrolidin-1-ylethyl)-2-[3-[3-[[2-(4-sulfamoylphenyl)ethylamino]methyl]phenyl]phenyl]acetamide;dihydrochloride (PubChem CID 139963174) has the molecular formula C29H38Cl2N4O3S and a molecular weight of 593.62 g/mol. Its IUPAC name is N-(2-pyrrolidin-1-ylethyl)-2-[3-[3-[[2-(4-sulfamoylphenyl)ethylamino]methyl]phenyl]phenyl]acetamide;dihydrochloride.
| Compound Name | N-(2-pyrrolidin-1-ylethyl)-2-[3-[3-[[2-(4-sulfamoylphenyl)ethylamino]methyl]phenyl]phenyl]acetamide;dihydrochloride |
|---|---|
| PubChem CID | 139963174 |
| Molecular Formula | C29H38Cl2N4O3S |
| Molecular Weight | 593.62 g/mol |
| Exact Mass | 592.20 |
| IUPAC Name | N-(2-pyrrolidin-1-ylethyl)-2-[3-[3-[[2-(4-sulfamoylphenyl)ethylamino]methyl]phenyl]phenyl]acetamide;dihydrochloride |
| SMILES | Cl.Cl.NS(=O)(=O)c1ccc(CCNCc2cccc(-c3cccc(CC(=O)NCCN4CCCC4)c3)c2)cc1 |
| InChI | InChI=1S/C29H36N4O3S.2ClH/c30-37(35,36)28-11-9-23(10-12-28)13-14-31-22-25-6-4-8-27(20-25)26-7-3-5-24(19-26)21-29(34)32-15-18-33-16-1-2-17-33;;/h3-12,19-20,31H,1-2,13-18,21-22H2,(H,32,34)(H2,30,35,36);2*1H |
| InChIKey | GASHRZBIJPNZHL-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.62 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|