C29H35N3O2 — CID 139963138
2-[3-[3-[[2-(4-hydroxyphenyl)ethylamino]methyl]phenyl]phenyl]-N-(2-pyrrolidin-1-ylethyl)acetamide (PubChem CID 139963138) has the molecular formula C29H35N3O2 and a molecular weight of 457.62 g/mol. Its IUPAC name is 2-[3-[3-[[2-(4-hydroxyphenyl)ethylamino]methyl]phenyl]phenyl]-N-(2-pyrrolidin-1-ylethyl)acetamide.
| Compound Name | 2-[3-[3-[[2-(4-hydroxyphenyl)ethylamino]methyl]phenyl]phenyl]-N-(2-pyrrolidin-1-ylethyl)acetamide |
|---|---|
| PubChem CID | 139963138 |
| Molecular Formula | C29H35N3O2 |
| Molecular Weight | 457.62 g/mol |
| Exact Mass | 457.27 |
| IUPAC Name | 2-[3-[3-[[2-(4-hydroxyphenyl)ethylamino]methyl]phenyl]phenyl]-N-(2-pyrrolidin-1-ylethyl)acetamide |
| SMILES | O=C(Cc1cccc(-c2cccc(CNCCc3ccc(O)cc3)c2)c1)NCCN1CCCC1 |
| InChI | InChI=1S/C29H35N3O2/c33-28-11-9-23(10-12-28)13-14-30-22-25-6-4-8-27(20-25)26-7-3-5-24(19-26)21-29(34)31-15-18-32-16-1-2-17-32/h3-12,19-20,30,33H,1-2,13-18,21-22H2,(H,31,34) |
| InChIKey | SVWYWHQJLJSADQ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.62 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|