C27H33N5O3S — CID 139963160
N-(2-pyrrolidin-1-ylethyl)-2-[3-[[2-(4-sulfamoylphenyl)ethylamino]methyl]phenyl]pyridine-4-carboxamide (PubChem CID 139963160) has the molecular formula C27H33N5O3S and a molecular weight of 507.66 g/mol. Its IUPAC name is N-(2-pyrrolidin-1-ylethyl)-2-[3-[[2-(4-sulfamoylphenyl)ethylamino]methyl]phenyl]pyridine-4-carboxamide.
| Compound Name | N-(2-pyrrolidin-1-ylethyl)-2-[3-[[2-(4-sulfamoylphenyl)ethylamino]methyl]phenyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 139963160 |
| Molecular Formula | C27H33N5O3S |
| Molecular Weight | 507.66 g/mol |
| Exact Mass | 507.23 |
| IUPAC Name | N-(2-pyrrolidin-1-ylethyl)-2-[3-[[2-(4-sulfamoylphenyl)ethylamino]methyl]phenyl]pyridine-4-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(CCNCc2cccc(-c3cc(C(=O)NCCN4CCCC4)ccn3)c2)cc1 |
| InChI | InChI=1S/C27H33N5O3S/c28-36(34,35)25-8-6-21(7-9-25)10-12-29-20-22-4-3-5-23(18-22)26-19-24(11-13-30-26)27(33)31-14-17-32-15-1-2-16-32/h3-9,11,13,18-19,29H,1-2,10,12,14-17,20H2,(H,31,33)(H2,28,34,35) |
| InChIKey | HQIBZRSMPBKQNF-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 117.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.66 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|