C26H31N5O2 — CID 58103516
3-[2-[2-(4-methoxyphenyl)ethylamino]pyrimidin-4-yl]-N-(2-pyrrolidin-1-ylethyl)benzamide (PubChem CID 58103516) has the molecular formula C26H31N5O2 and a molecular weight of 445.57 g/mol. Its IUPAC name is 3-[2-[2-(4-methoxyphenyl)ethylamino]pyrimidin-4-yl]-N-(2-pyrrolidin-1-ylethyl)benzamide.
| Compound Name | 3-[2-[2-(4-methoxyphenyl)ethylamino]pyrimidin-4-yl]-N-(2-pyrrolidin-1-ylethyl)benzamide |
|---|---|
| PubChem CID | 58103516 |
| Molecular Formula | C26H31N5O2 |
| Molecular Weight | 445.57 g/mol |
| Exact Mass | 445.25 |
| IUPAC Name | 3-[2-[2-(4-methoxyphenyl)ethylamino]pyrimidin-4-yl]-N-(2-pyrrolidin-1-ylethyl)benzamide |
| SMILES | COc1ccc(CCNc2nccc(-c3cccc(C(=O)NCCN4CCCC4)c3)n2)cc1 |
| InChI | InChI=1S/C26H31N5O2/c1-33-23-9-7-20(8-10-23)11-13-28-26-29-14-12-24(30-26)21-5-4-6-22(19-21)25(32)27-15-18-31-16-2-3-17-31/h4-10,12,14,19H,2-3,11,13,15-18H2,1H3,(H,27,32)(H,28,29,30) |
| InChIKey | CRSRGAVECRJDQB-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.57 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |