C26H33N5O3 — CID 58103381
3-[2-[2-(3,4-dimethoxyphenyl)ethylamino]pyrimidin-4-yl]-N-[3-(dimethylamino)propyl]benzamide (PubChem CID 58103381) has the molecular formula C26H33N5O3 and a molecular weight of 463.58 g/mol. Its IUPAC name is 3-[2-[2-(3,4-dimethoxyphenyl)ethylamino]pyrimidin-4-yl]-N-[3-(dimethylamino)propyl]benzamide.
| Compound Name | 3-[2-[2-(3,4-dimethoxyphenyl)ethylamino]pyrimidin-4-yl]-N-[3-(dimethylamino)propyl]benzamide |
|---|---|
| PubChem CID | 58103381 |
| Molecular Formula | C26H33N5O3 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.26 |
| IUPAC Name | 3-[2-[2-(3,4-dimethoxyphenyl)ethylamino]pyrimidin-4-yl]-N-[3-(dimethylamino)propyl]benzamide |
| SMILES | COc1ccc(CCNc2nccc(-c3cccc(C(=O)NCCCN(C)C)c3)n2)cc1OC |
| InChI | InChI=1S/C26H33N5O3/c1-31(2)16-6-13-27-25(32)21-8-5-7-20(18-21)22-12-15-29-26(30-22)28-14-11-19-9-10-23(33-3)24(17-19)34-4/h5,7-10,12,15,17-18H,6,11,13-14,16H2,1-4H3,(H,27,32)(H,28,29,30) |
| InChIKey | XKGZUIVXQHEEIC-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|