C25H30N4O3 — CID 66859219
N-[3-[2-[2-(3,4-dimethoxyphenyl)ethylamino]pyrimidin-4-yl]phenyl]pentanamide (PubChem CID 66859219) has the molecular formula C25H30N4O3 and a molecular weight of 434.54 g/mol. Its IUPAC name is N-[3-[2-[2-(3,4-dimethoxyphenyl)ethylamino]pyrimidin-4-yl]phenyl]pentanamide.
| Compound Name | N-[3-[2-[2-(3,4-dimethoxyphenyl)ethylamino]pyrimidin-4-yl]phenyl]pentanamide |
|---|---|
| PubChem CID | 66859219 |
| Molecular Formula | C25H30N4O3 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | N-[3-[2-[2-(3,4-dimethoxyphenyl)ethylamino]pyrimidin-4-yl]phenyl]pentanamide |
| SMILES | CCCCC(=O)Nc1cccc(-c2ccnc(NCCc3ccc(OC)c(OC)c3)n2)c1 |
| InChI | InChI=1S/C25H30N4O3/c1-4-5-9-24(30)28-20-8-6-7-19(17-20)21-13-15-27-25(29-21)26-14-12-18-10-11-22(31-2)23(16-18)32-3/h6-8,10-11,13,15-17H,4-5,9,12,14H2,1-3H3,(H,28,30)(H,26,27,29) |
| InChIKey | GIITXNZILCJZGR-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |