C25H27N3O5 — CID 58103273
N'-[3-[6-[2-(3,4-dimethoxyphenyl)ethoxy]-2-pyridinyl]phenyl]butanediamide (PubChem CID 58103273) has the molecular formula C25H27N3O5 and a molecular weight of 449.51 g/mol. Its IUPAC name is N'-[3-[6-[2-(3,4-dimethoxyphenyl)ethoxy]-2-pyridinyl]phenyl]butanediamide.
| Compound Name | N'-[3-[6-[2-(3,4-dimethoxyphenyl)ethoxy]-2-pyridinyl]phenyl]butanediamide |
|---|---|
| PubChem CID | 58103273 |
| Molecular Formula | C25H27N3O5 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | N'-[3-[6-[2-(3,4-dimethoxyphenyl)ethoxy]-2-pyridinyl]phenyl]butanediamide |
| SMILES | COc1ccc(CCOc2cccc(-c3cccc(NC(=O)CCC(N)=O)c3)n2)cc1OC |
| InChI | InChI=1S/C25H27N3O5/c1-31-21-10-9-17(15-22(21)32-2)13-14-33-25-8-4-7-20(28-25)18-5-3-6-19(16-18)27-24(30)12-11-23(26)29/h3-10,15-16H,11-14H2,1-2H3,(H2,26,29)(H,27,30) |
| InChIKey | ARBZQFWSZUNMOK-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 112.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |