C30H29N3O5 — CID 58103239
3-acetamido-N-[3-[6-[2-(3,4-dimethoxyphenyl)ethoxy]-2-pyridinyl]phenyl]benzamide (PubChem CID 58103239) has the molecular formula C30H29N3O5 and a molecular weight of 511.58 g/mol. Its IUPAC name is 3-acetamido-N-[3-[6-[2-(3,4-dimethoxyphenyl)ethoxy]-2-pyridinyl]phenyl]benzamide.
| Compound Name | 3-acetamido-N-[3-[6-[2-(3,4-dimethoxyphenyl)ethoxy]-2-pyridinyl]phenyl]benzamide |
|---|---|
| PubChem CID | 58103239 |
| Molecular Formula | C30H29N3O5 |
| Molecular Weight | 511.58 g/mol |
| Exact Mass | 511.21 |
| IUPAC Name | 3-acetamido-N-[3-[6-[2-(3,4-dimethoxyphenyl)ethoxy]-2-pyridinyl]phenyl]benzamide |
| SMILES | COc1ccc(CCOc2cccc(-c3cccc(NC(=O)c4cccc(NC(C)=O)c4)c3)n2)cc1OC |
| InChI | InChI=1S/C30H29N3O5/c1-20(34)31-24-9-5-8-23(19-24)30(35)32-25-10-4-7-22(18-25)26-11-6-12-29(33-26)38-16-15-21-13-14-27(36-2)28(17-21)37-3/h4-14,17-19H,15-16H2,1-3H3,(H,31,34)(H,32,35) |
| InChIKey | MSDRPLGKQDVSLN-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 98.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.58 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |