C25H29N5O5 — CID 68628144
3-[[3-[2-[2-(3,4-dimethoxyphenyl)ethylamino]pyrimidin-4-yl]benzoyl]amino]propylcarbamic acid (PubChem CID 68628144) has the molecular formula C25H29N5O5 and a molecular weight of 479.54 g/mol. Its IUPAC name is 3-[[3-[2-[2-(3,4-dimethoxyphenyl)ethylamino]pyrimidin-4-yl]benzoyl]amino]propylcarbamic acid.
| Compound Name | 3-[[3-[2-[2-(3,4-dimethoxyphenyl)ethylamino]pyrimidin-4-yl]benzoyl]amino]propylcarbamic acid |
|---|---|
| PubChem CID | 68628144 |
| Molecular Formula | C25H29N5O5 |
| Molecular Weight | 479.54 g/mol |
| Exact Mass | 479.22 |
| IUPAC Name | 3-[[3-[2-[2-(3,4-dimethoxyphenyl)ethylamino]pyrimidin-4-yl]benzoyl]amino]propylcarbamic acid |
| SMILES | COc1ccc(CCNc2nccc(-c3cccc(C(=O)NCCCNC(=O)O)c3)n2)cc1OC |
| InChI | InChI=1S/C25H29N5O5/c1-34-21-8-7-17(15-22(21)35-2)9-13-27-24-28-14-10-20(30-24)18-5-3-6-19(16-18)23(31)26-11-4-12-29-25(32)33/h3,5-8,10,14-16,29H,4,9,11-13H2,1-2H3,(H,26,31)(H,32,33)(H,27,28,30) |
| InChIKey | CBOIRYPDJUKGLE-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 134.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.54 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|