C23H28F3N3O — CID 42852643
N-(2-piperidin-1-ylethyl)-2-[4-[[3-(trifluoromethyl)phenyl]methylamino]phenyl]acetamide (PubChem CID 42852643) has the molecular formula C23H28F3N3O and a molecular weight of 419.49 g/mol. Its IUPAC name is N-(2-piperidin-1-ylethyl)-2-[4-[[3-(trifluoromethyl)phenyl]methylamino]phenyl]acetamide.
| Compound Name | N-(2-piperidin-1-ylethyl)-2-[4-[[3-(trifluoromethyl)phenyl]methylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 42852643 |
| Molecular Formula | C23H28F3N3O |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | N-(2-piperidin-1-ylethyl)-2-[4-[[3-(trifluoromethyl)phenyl]methylamino]phenyl]acetamide |
| SMILES | O=C(Cc1ccc(NCc2cccc(C(F)(F)F)c2)cc1)NCCN1CCCCC1 |
| InChI | InChI=1S/C23H28F3N3O/c24-23(25,26)20-6-4-5-19(15-20)17-28-21-9-7-18(8-10-21)16-22(30)27-11-14-29-12-2-1-3-13-29/h4-10,15,28H,1-3,11-14,16-17H2,(H,27,30) |
| InChIKey | LOGBGFVRDLTKIR-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |