C17H17F3N2O3S — CID 3640741
N-[2-(4-sulfamoylphenyl)ethyl]-2-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 3640741) has the molecular formula C17H17F3N2O3S and a molecular weight of 386.40 g/mol. Its IUPAC name is N-[2-(4-sulfamoylphenyl)ethyl]-2-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-[2-(4-sulfamoylphenyl)ethyl]-2-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 3640741 |
| Molecular Formula | C17H17F3N2O3S |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | N-[2-(4-sulfamoylphenyl)ethyl]-2-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | NS(=O)(=O)c1ccc(CCNC(=O)Cc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C17H17F3N2O3S/c18-17(19,20)14-3-1-2-13(10-14)11-16(23)22-9-8-12-4-6-15(7-5-12)26(21,24)25/h1-7,10H,8-9,11H2,(H,22,23)(H2,21,24,25) |
| InChIKey | HVGZYBHGJLFMJC-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |