C17H17F3N2O3S — CID 24672657
2-methyl-5-sulfamoyl-N-[2-[4-(trifluoromethyl)phenyl]ethyl]benzamide (PubChem CID 24672657) has the molecular formula C17H17F3N2O3S and a molecular weight of 386.40 g/mol. Its IUPAC name is 2-methyl-5-sulfamoyl-N-[2-[4-(trifluoromethyl)phenyl]ethyl]benzamide.
| Compound Name | 2-methyl-5-sulfamoyl-N-[2-[4-(trifluoromethyl)phenyl]ethyl]benzamide |
|---|---|
| PubChem CID | 24672657 |
| Molecular Formula | C17H17F3N2O3S |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | 2-methyl-5-sulfamoyl-N-[2-[4-(trifluoromethyl)phenyl]ethyl]benzamide |
| SMILES | Cc1ccc(S(N)(=O)=O)cc1C(=O)NCCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H17F3N2O3S/c1-11-2-7-14(26(21,24)25)10-15(11)16(23)22-9-8-12-3-5-13(6-4-12)17(18,19)20/h2-7,10H,8-9H2,1H3,(H,22,23)(H2,21,24,25) |
| InChIKey | MTJDQUNSNUAMJX-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |