C11H13F3N2O3S — CID 63228100
2-methyl-4-sulfamoyl-N-(3,3,3-trifluoropropyl)benzamide (PubChem CID 63228100) has the molecular formula C11H13F3N2O3S and a molecular weight of 310.30 g/mol. Its IUPAC name is 2-methyl-4-sulfamoyl-N-(3,3,3-trifluoropropyl)benzamide.
| Compound Name | 2-methyl-4-sulfamoyl-N-(3,3,3-trifluoropropyl)benzamide |
|---|---|
| PubChem CID | 63228100 |
| Molecular Formula | C11H13F3N2O3S |
| Molecular Weight | 310.30 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | 2-methyl-4-sulfamoyl-N-(3,3,3-trifluoropropyl)benzamide |
| SMILES | Cc1cc(S(N)(=O)=O)ccc1C(=O)NCCC(F)(F)F |
| InChI | InChI=1S/C11H13F3N2O3S/c1-7-6-8(20(15,18)19)2-3-9(7)10(17)16-5-4-11(12,13)14/h2-3,6H,4-5H2,1H3,(H,16,17)(H2,15,18,19) |
| InChIKey | XJJQZSDIDHYOEN-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.30 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |