C10H9F5N2O3S — CID 65388478
2,5-difluoro-3-sulfamoyl-N-(3,3,3-trifluoropropyl)benzamide (PubChem CID 65388478) has the molecular formula C10H9F5N2O3S and a molecular weight of 332.25 g/mol. Its IUPAC name is 2,5-difluoro-3-sulfamoyl-N-(3,3,3-trifluoropropyl)benzamide.
| Compound Name | 2,5-difluoro-3-sulfamoyl-N-(3,3,3-trifluoropropyl)benzamide |
|---|---|
| PubChem CID | 65388478 |
| Molecular Formula | C10H9F5N2O3S |
| Molecular Weight | 332.25 g/mol |
| Exact Mass | 332.03 |
| IUPAC Name | 2,5-difluoro-3-sulfamoyl-N-(3,3,3-trifluoropropyl)benzamide |
| SMILES | NS(=O)(=O)c1cc(F)cc(C(=O)NCCC(F)(F)F)c1F |
| InChI | InChI=1S/C10H9F5N2O3S/c11-5-3-6(8(12)7(4-5)21(16,19)20)9(18)17-2-1-10(13,14)15/h3-4H,1-2H2,(H,17,18)(H2,16,19,20) |
| InChIKey | YQRAFHZONUDLDH-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.25 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |