C12H14F2N2O3S — CID 65386252
N-(1-cyclopropylethyl)-2,5-difluoro-3-sulfamoylbenzamide (PubChem CID 65386252) has the molecular formula C12H14F2N2O3S and a molecular weight of 304.32 g/mol. Its IUPAC name is N-(1-cyclopropylethyl)-2,5-difluoro-3-sulfamoylbenzamide.
| Compound Name | N-(1-cyclopropylethyl)-2,5-difluoro-3-sulfamoylbenzamide |
|---|---|
| PubChem CID | 65386252 |
| Molecular Formula | C12H14F2N2O3S |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | N-(1-cyclopropylethyl)-2,5-difluoro-3-sulfamoylbenzamide |
| SMILES | CC(NC(=O)c1cc(F)cc(S(N)(=O)=O)c1F)C1CC1 |
| InChI | InChI=1S/C12H14F2N2O3S/c1-6(7-2-3-7)16-12(17)9-4-8(13)5-10(11(9)14)20(15,18)19/h4-7H,2-3H2,1H3,(H,16,17)(H2,15,18,19) |
| InChIKey | XDNWGZAOTUZDJZ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |