C12H14BrFN2O3S — CID 63933111
2-bromo-N-(1-cyclopropylethyl)-5-fluoro-3-sulfamoylbenzamide (PubChem CID 63933111) has the molecular formula C12H14BrFN2O3S and a molecular weight of 365.22 g/mol. Its IUPAC name is 2-bromo-N-(1-cyclopropylethyl)-5-fluoro-3-sulfamoylbenzamide.
| Compound Name | 2-bromo-N-(1-cyclopropylethyl)-5-fluoro-3-sulfamoylbenzamide |
|---|---|
| PubChem CID | 63933111 |
| Molecular Formula | C12H14BrFN2O3S |
| Molecular Weight | 365.22 g/mol |
| Exact Mass | 363.99 |
| IUPAC Name | 2-bromo-N-(1-cyclopropylethyl)-5-fluoro-3-sulfamoylbenzamide |
| SMILES | CC(NC(=O)c1cc(F)cc(S(N)(=O)=O)c1Br)C1CC1 |
| InChI | InChI=1S/C12H14BrFN2O3S/c1-6(7-2-3-7)16-12(17)9-4-8(14)5-10(11(9)13)20(15,18)19/h4-7H,2-3H2,1H3,(H,16,17)(H2,15,18,19) |
| InChIKey | DPBVJPNOAWNLDG-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.22 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |