C15H13BrClFN2O3S — CID 95763345
2-bromo-N-[(1S)-1-(2-chlorophenyl)ethyl]-5-fluoro-3-sulfamoylbenzamide (PubChem CID 95763345) has the molecular formula C15H13BrClFN2O3S and a molecular weight of 435.70 g/mol. Its IUPAC name is 2-bromo-N-[(1S)-1-(2-chlorophenyl)ethyl]-5-fluoro-3-sulfamoylbenzamide.
| Compound Name | 2-bromo-N-[(1S)-1-(2-chlorophenyl)ethyl]-5-fluoro-3-sulfamoylbenzamide |
|---|---|
| PubChem CID | 95763345 |
| Molecular Formula | C15H13BrClFN2O3S |
| Molecular Weight | 435.70 g/mol |
| Exact Mass | 433.95 |
| IUPAC Name | 2-bromo-N-[(1S)-1-(2-chlorophenyl)ethyl]-5-fluoro-3-sulfamoylbenzamide |
| SMILES | C[C@H](NC(=O)c1cc(F)cc(S(N)(=O)=O)c1Br)c1ccccc1Cl |
| InChI | InChI=1S/C15H13BrClFN2O3S/c1-8(10-4-2-3-5-12(10)17)20-15(21)11-6-9(18)7-13(14(11)16)24(19,22)23/h2-8H,1H3,(H,20,21)(H2,19,22,23)/t8-/m0/s1 |
| InChIKey | QJYVVXBAUYZINZ-QMMMGPOBSA-N |
| XLogP | 3.38 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.70 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |