C10H10F4N2O3S — CID 65373702
5-fluoro-2-methyl-3-sulfamoyl-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 65373702) has the molecular formula C10H10F4N2O3S and a molecular weight of 314.26 g/mol. Its IUPAC name is 5-fluoro-2-methyl-3-sulfamoyl-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 5-fluoro-2-methyl-3-sulfamoyl-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 65373702 |
| Molecular Formula | C10H10F4N2O3S |
| Molecular Weight | 314.26 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | 5-fluoro-2-methyl-3-sulfamoyl-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | Cc1c(C(=O)NCC(F)(F)F)cc(F)cc1S(N)(=O)=O |
| InChI | InChI=1S/C10H10F4N2O3S/c1-5-7(9(17)16-4-10(12,13)14)2-6(11)3-8(5)20(15,18)19/h2-3H,4H2,1H3,(H,16,17)(H2,15,18,19) |
| InChIKey | KBGLRBRGCWIPJQ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.26 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |