C13H19ClN2O4S — CID 104766748
5-chloro-N-(2-methoxy-2-methylpropyl)-2-methyl-3-sulfamoylbenzamide (PubChem CID 104766748) has the molecular formula C13H19ClN2O4S and a molecular weight of 334.83 g/mol. Its IUPAC name is 5-chloro-N-(2-methoxy-2-methylpropyl)-2-methyl-3-sulfamoylbenzamide.
| Compound Name | 5-chloro-N-(2-methoxy-2-methylpropyl)-2-methyl-3-sulfamoylbenzamide |
|---|---|
| PubChem CID | 104766748 |
| Molecular Formula | C13H19ClN2O4S |
| Molecular Weight | 334.83 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | 5-chloro-N-(2-methoxy-2-methylpropyl)-2-methyl-3-sulfamoylbenzamide |
| SMILES | COC(C)(C)CNC(=O)c1cc(Cl)cc(S(N)(=O)=O)c1C |
| InChI | InChI=1S/C13H19ClN2O4S/c1-8-10(12(17)16-7-13(2,3)20-4)5-9(14)6-11(8)21(15,18)19/h5-6H,7H2,1-4H3,(H,16,17)(H2,15,18,19) |
| InChIKey | DRCLDROXGYZJSX-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.83 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |