C11H13ClN2O3S — CID 82891438
5-chloro-N-cyclopropyl-2-methyl-3-sulfamoylbenzamide (PubChem CID 82891438) has the molecular formula C11H13ClN2O3S and a molecular weight of 288.76 g/mol. Its IUPAC name is 5-chloro-N-cyclopropyl-2-methyl-3-sulfamoylbenzamide.
| Compound Name | 5-chloro-N-cyclopropyl-2-methyl-3-sulfamoylbenzamide |
|---|---|
| PubChem CID | 82891438 |
| Molecular Formula | C11H13ClN2O3S |
| Molecular Weight | 288.76 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | 5-chloro-N-cyclopropyl-2-methyl-3-sulfamoylbenzamide |
| SMILES | Cc1c(C(=O)NC2CC2)cc(Cl)cc1S(N)(=O)=O |
| InChI | InChI=1S/C11H13ClN2O3S/c1-6-9(11(15)14-8-2-3-8)4-7(12)5-10(6)18(13,16)17/h4-5,8H,2-3H2,1H3,(H,14,15)(H2,13,16,17) |
| InChIKey | KOCFTQSCERVIBT-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.76 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |