C9H7BrF4N2O3S — CID 65374272
4-bromo-3-fluoro-5-sulfamoyl-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 65374272) has the molecular formula C9H7BrF4N2O3S and a molecular weight of 379.13 g/mol. Its IUPAC name is 4-bromo-3-fluoro-5-sulfamoyl-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 4-bromo-3-fluoro-5-sulfamoyl-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 65374272 |
| Molecular Formula | C9H7BrF4N2O3S |
| Molecular Weight | 379.13 g/mol |
| Exact Mass | 377.93 |
| IUPAC Name | 4-bromo-3-fluoro-5-sulfamoyl-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | NS(=O)(=O)c1cc(C(=O)NCC(F)(F)F)cc(F)c1Br |
| InChI | InChI=1S/C9H7BrF4N2O3S/c10-7-5(11)1-4(2-6(7)20(15,18)19)8(17)16-3-9(12,13)14/h1-2H,3H2,(H,16,17)(H2,15,18,19) |
| InChIKey | MDWYBNQSTVBRIZ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.13 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |