C9H10BrFN2O3S — CID 65374812
4-bromo-N-ethyl-3-fluoro-5-sulfamoylbenzamide (PubChem CID 65374812) has the molecular formula C9H10BrFN2O3S and a molecular weight of 325.16 g/mol. Its IUPAC name is 4-bromo-N-ethyl-3-fluoro-5-sulfamoylbenzamide.
| Compound Name | 4-bromo-N-ethyl-3-fluoro-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 65374812 |
| Molecular Formula | C9H10BrFN2O3S |
| Molecular Weight | 325.16 g/mol |
| Exact Mass | 323.96 |
| IUPAC Name | 4-bromo-N-ethyl-3-fluoro-5-sulfamoylbenzamide |
| SMILES | CCNC(=O)c1cc(F)c(Br)c(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C9H10BrFN2O3S/c1-2-13-9(14)5-3-6(11)8(10)7(4-5)17(12,15)16/h3-4H,2H2,1H3,(H,13,14)(H2,12,15,16) |
| InChIKey | VKNGGLVGXHZOJM-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.16 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |