C12H15BrFNO4S — CID 65380255
3-methylbutyl 4-bromo-3-fluoro-5-sulfamoylbenzoate (PubChem CID 65380255) has the molecular formula C12H15BrFNO4S and a molecular weight of 368.22 g/mol. Its IUPAC name is 3-methylbutyl 4-bromo-3-fluoro-5-sulfamoylbenzoate.
| Compound Name | 3-methylbutyl 4-bromo-3-fluoro-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 65380255 |
| Molecular Formula | C12H15BrFNO4S |
| Molecular Weight | 368.22 g/mol |
| Exact Mass | 366.99 |
| IUPAC Name | 3-methylbutyl 4-bromo-3-fluoro-5-sulfamoylbenzoate |
| SMILES | CC(C)CCOC(=O)c1cc(F)c(Br)c(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C12H15BrFNO4S/c1-7(2)3-4-19-12(16)8-5-9(14)11(13)10(6-8)20(15,17)18/h5-7H,3-4H2,1-2H3,(H2,15,17,18) |
| InChIKey | GERLVDKEPLCIEG-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.22 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |