C14H20FNO4S — CID 65381677
4-methylpentyl 3-fluoro-4-methyl-5-sulfamoylbenzoate (PubChem CID 65381677) has the molecular formula C14H20FNO4S and a molecular weight of 317.38 g/mol. Its IUPAC name is 4-methylpentyl 3-fluoro-4-methyl-5-sulfamoylbenzoate.
| Compound Name | 4-methylpentyl 3-fluoro-4-methyl-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 65381677 |
| Molecular Formula | C14H20FNO4S |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | 4-methylpentyl 3-fluoro-4-methyl-5-sulfamoylbenzoate |
| SMILES | Cc1c(F)cc(C(=O)OCCCC(C)C)cc1S(N)(=O)=O |
| InChI | InChI=1S/C14H20FNO4S/c1-9(2)5-4-6-20-14(17)11-7-12(15)10(3)13(8-11)21(16,18)19/h7-9H,4-6H2,1-3H3,(H2,16,18,19) |
| InChIKey | QUZUOLNMEJUBES-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|