C13H17Cl2NO4S — CID 65381474
4-methylpentyl 2,6-dichloro-3-sulfamoylbenzoate (PubChem CID 65381474) has the molecular formula C13H17Cl2NO4S and a molecular weight of 354.26 g/mol. Its IUPAC name is 4-methylpentyl 2,6-dichloro-3-sulfamoylbenzoate.
| Compound Name | 4-methylpentyl 2,6-dichloro-3-sulfamoylbenzoate |
|---|---|
| PubChem CID | 65381474 |
| Molecular Formula | C13H17Cl2NO4S |
| Molecular Weight | 354.26 g/mol |
| Exact Mass | 353.03 |
| IUPAC Name | 4-methylpentyl 2,6-dichloro-3-sulfamoylbenzoate |
| SMILES | CC(C)CCCOC(=O)c1c(Cl)ccc(S(N)(=O)=O)c1Cl |
| InChI | InChI=1S/C13H17Cl2NO4S/c1-8(2)4-3-7-20-13(17)11-9(14)5-6-10(12(11)15)21(16,18)19/h5-6,8H,3-4,7H2,1-2H3,(H2,16,18,19) |
| InChIKey | TZLRHVDIDZIVBX-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.26 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|