About 4-methylpentyl 2,6-dichloro-3-sulfamoylbenzoate
4-methylpentyl 2,6-dichloro-3-sulfamoylbenzoate (PubChem CID 65381474) has the molecular formula C13H17Cl2NO4S
and a molecular weight of 354.26 g/mol. Its IUPAC name is 4-methylpentyl 2,6-dichloro-3-sulfamoylbenzoate.
Molecular Properties
| Compound Name | 4-methylpentyl 2,6-dichloro-3-sulfamoylbenzoate |
| PubChem CID | 65381474 |
| Molecular Formula | C13H17Cl2NO4S |
| Molecular Weight | 354.26 g/mol |
| Exact Mass | 353.03 |
| IUPAC Name | 4-methylpentyl 2,6-dichloro-3-sulfamoylbenzoate |
| SMILES | CC(C)CCCOC(=O)c1c(Cl)ccc(S(N)(=O)=O)c1Cl |
| InChI | InChI=1S/C13H17Cl2NO4S/c1-8(2)4-3-7-20-13(17)11-9(14)5-6-10(12(11)15)21(16,18)19/h5-6,8H,3-4,7H2,1-2H3,(H2,16,18,19) |
| InChIKey | TZLRHVDIDZIVBX-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.26 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-methylpentyl 2,6-dichloro-3-sulfamoylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylpentyl 2,6-dichloro-3-sulfamoylbenzoate?
The IUPAC name of 4-methylpentyl 2,6-dichloro-3-sulfamoylbenzoate (CID 65381474) is 4-methylpentyl 2,6-dichloro-3-sulfamoylbenzoate.
What is the SMILES notation for 4-methylpentyl 2,6-dichloro-3-sulfamoylbenzoate?
The canonical SMILES for 4-methylpentyl 2,6-dichloro-3-sulfamoylbenzoate is CC(C)CCCOC(=O)c1c(Cl)ccc(S(N)(=O)=O)c1Cl.
What is the InChIKey of 4-methylpentyl 2,6-dichloro-3-sulfamoylbenzoate?
The InChIKey is TZLRHVDIDZIVBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17Cl2NO4S/c1-8(2)4-3-7-20-13(17)11-9(14)5-6-10(12(11)15)21(16,18)19/h5-6,8H,3-4,7H2,1-2H3,(H2,16,18,19).
What are the key properties of 4-methylpentyl 2,6-dichloro-3-sulfamoylbenzoate?
4-methylpentyl 2,6-dichloro-3-sulfamoylbenzoate has a molecular weight of 354.26 g/mol, XLogP of 3.23, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylpentyl 2,6-dichloro-3-sulfamoylbenzoate is sourced from PubChem (CID 65381474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).