About 2-oxo-2-[3,4,6-trichloro-2-(4-methylpentoxycarbonyl)phenoxy]acetic acid
2-oxo-2-[3,4,6-trichloro-2-(4-methylpentoxycarbonyl)phenoxy]acetic acid (PubChem CID 87275812) has the molecular formula C15H15Cl3O6
and a molecular weight of 397.64 g/mol. Its IUPAC name is 2-oxo-2-[3,4,6-trichloro-2-(4-methylpentoxycarbonyl)phenoxy]acetic acid.
Molecular Properties
| Compound Name | 2-oxo-2-[3,4,6-trichloro-2-(4-methylpentoxycarbonyl)phenoxy]acetic acid |
| PubChem CID | 87275812 |
| Molecular Formula | C15H15Cl3O6 |
| Molecular Weight | 397.64 g/mol |
| Exact Mass | 395.99 |
| IUPAC Name | 2-oxo-2-[3,4,6-trichloro-2-(4-methylpentoxycarbonyl)phenoxy]acetic acid |
| SMILES | CC(C)CCCOC(=O)c1c(Cl)c(Cl)cc(Cl)c1OC(=O)C(=O)O |
| InChI | InChI=1S/C15H15Cl3O6/c1-7(2)4-3-5-23-14(21)10-11(18)8(16)6-9(17)12(10)24-15(22)13(19)20/h6-7H,3-5H2,1-2H3,(H,19,20) |
| InChIKey | UDLIQMYWODDGMS-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.64 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 2-oxo-2-[3,4,6-trichloro-2-(4-methylpentoxycarbonyl)phenoxy]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxo-2-[3,4,6-trichloro-2-(4-methylpentoxycarbonyl)phenoxy]acetic acid?
The IUPAC name of 2-oxo-2-[3,4,6-trichloro-2-(4-methylpentoxycarbonyl)phenoxy]acetic acid (CID 87275812) is 2-oxo-2-[3,4,6-trichloro-2-(4-methylpentoxycarbonyl)phenoxy]acetic acid.
What is the SMILES notation for 2-oxo-2-[3,4,6-trichloro-2-(4-methylpentoxycarbonyl)phenoxy]acetic acid?
The canonical SMILES for 2-oxo-2-[3,4,6-trichloro-2-(4-methylpentoxycarbonyl)phenoxy]acetic acid is CC(C)CCCOC(=O)c1c(Cl)c(Cl)cc(Cl)c1OC(=O)C(=O)O.
What is the InChIKey of 2-oxo-2-[3,4,6-trichloro-2-(4-methylpentoxycarbonyl)phenoxy]acetic acid?
The InChIKey is UDLIQMYWODDGMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15Cl3O6/c1-7(2)4-3-5-23-14(21)10-11(18)8(16)6-9(17)12(10)24-15(22)13(19)20/h6-7H,3-5H2,1-2H3,(H,19,20).
What are the key properties of 2-oxo-2-[3,4,6-trichloro-2-(4-methylpentoxycarbonyl)phenoxy]acetic acid?
2-oxo-2-[3,4,6-trichloro-2-(4-methylpentoxycarbonyl)phenoxy]acetic acid has a molecular weight of 397.64 g/mol, XLogP of 4.23, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxo-2-[3,4,6-trichloro-2-(4-methylpentoxycarbonyl)phenoxy]acetic acid is sourced from PubChem (CID 87275812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).