C15H15Cl3O6 — CID 87275812
2-oxo-2-[3,4,6-trichloro-2-(4-methylpentoxycarbonyl)phenoxy]acetic acid (PubChem CID 87275812) has the molecular formula C15H15Cl3O6 and a molecular weight of 397.64 g/mol. Its IUPAC name is 2-oxo-2-[3,4,6-trichloro-2-(4-methylpentoxycarbonyl)phenoxy]acetic acid.
| Compound Name | 2-oxo-2-[3,4,6-trichloro-2-(4-methylpentoxycarbonyl)phenoxy]acetic acid |
|---|---|
| PubChem CID | 87275812 |
| Molecular Formula | C15H15Cl3O6 |
| Molecular Weight | 397.64 g/mol |
| Exact Mass | 395.99 |
| IUPAC Name | 2-oxo-2-[3,4,6-trichloro-2-(4-methylpentoxycarbonyl)phenoxy]acetic acid |
| SMILES | CC(C)CCCOC(=O)c1c(Cl)c(Cl)cc(Cl)c1OC(=O)C(=O)O |
| InChI | InChI=1S/C15H15Cl3O6/c1-7(2)4-3-5-23-14(21)10-11(18)8(16)6-9(17)12(10)24-15(22)13(19)20/h6-7H,3-5H2,1-2H3,(H,19,20) |
| InChIKey | UDLIQMYWODDGMS-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.64 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|