C17H19Cl3O6 — CID 151134332
2-oxo-2-[3,4,6-trichloro-2-(4,5-dimethylhexoxycarbonyl)phenoxy]acetic acid (PubChem CID 151134332) has the molecular formula C17H19Cl3O6 and a molecular weight of 425.69 g/mol. Its IUPAC name is 2-oxo-2-[3,4,6-trichloro-2-(4,5-dimethylhexoxycarbonyl)phenoxy]acetic acid.
| Compound Name | 2-oxo-2-[3,4,6-trichloro-2-(4,5-dimethylhexoxycarbonyl)phenoxy]acetic acid |
|---|---|
| PubChem CID | 151134332 |
| Molecular Formula | C17H19Cl3O6 |
| Molecular Weight | 425.69 g/mol |
| Exact Mass | 424.02 |
| IUPAC Name | 2-oxo-2-[3,4,6-trichloro-2-(4,5-dimethylhexoxycarbonyl)phenoxy]acetic acid |
| SMILES | CC(C)C(C)CCCOC(=O)c1c(Cl)c(Cl)cc(Cl)c1OC(=O)C(=O)O |
| InChI | InChI=1S/C17H19Cl3O6/c1-8(2)9(3)5-4-6-25-16(23)12-13(20)10(18)7-11(19)14(12)26-17(24)15(21)22/h7-9H,4-6H2,1-3H3,(H,21,22) |
| InChIKey | MUWSFDWHVVMWOG-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.69 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|