C34H40Cl6O8 — CID 87273304
bis[3,4,6-trichloro-2-(3-ethyl-5-methylhexoxy)carbonylphenyl] oxalate (PubChem CID 87273304) has the molecular formula C34H40Cl6O8 and a molecular weight of 789.40 g/mol. Its IUPAC name is bis[3,4,6-trichloro-2-(3-ethyl-5-methylhexoxy)carbonylphenyl] oxalate.
| Compound Name | bis[3,4,6-trichloro-2-(3-ethyl-5-methylhexoxy)carbonylphenyl] oxalate |
|---|---|
| PubChem CID | 87273304 |
| Molecular Formula | C34H40Cl6O8 |
| Molecular Weight | 789.40 g/mol |
| Exact Mass | 786.09 |
| IUPAC Name | bis[3,4,6-trichloro-2-(3-ethyl-5-methylhexoxy)carbonylphenyl] oxalate |
| SMILES | CCC(CCOC(=O)c1c(Cl)c(Cl)cc(Cl)c1OC(=O)C(=O)Oc1c(Cl)cc(Cl)c(Cl)c1C(=O)OCCC(CC)CC(C)C)CC(C)C |
| InChI | InChI=1S/C34H40Cl6O8/c1-7-19(13-17(3)4)9-11-45-31(41)25-27(39)21(35)15-23(37)29(25)47-33(43)34(44)48-30-24(38)16-22(36)28(40)26(30)32(42)46-12-10-20(8-2)14-18(5)6/h15-20H,7-14H2,1-6H3 |
| InChIKey | PKHIKYLQLPPBLV-UHFFFAOYSA-N |
| XLogP | 11.36 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.40 |
| LogP ≤ 5 | 11.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|