About 4-methylpentyl 3-chlorosulfonyl-5-fluoro-2-methylbenzoate
4-methylpentyl 3-chlorosulfonyl-5-fluoro-2-methylbenzoate (PubChem CID 65373345) has the molecular formula C14H18ClFO4S
and a molecular weight of 336.81 g/mol. Its IUPAC name is 4-methylpentyl 3-chlorosulfonyl-5-fluoro-2-methylbenzoate.
Molecular Properties
| Compound Name | 4-methylpentyl 3-chlorosulfonyl-5-fluoro-2-methylbenzoate |
| PubChem CID | 65373345 |
| Molecular Formula | C14H18ClFO4S |
| Molecular Weight | 336.81 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | 4-methylpentyl 3-chlorosulfonyl-5-fluoro-2-methylbenzoate |
| SMILES | Cc1c(C(=O)OCCCC(C)C)cc(F)cc1S(=O)(=O)Cl |
| InChI | InChI=1S/C14H18ClFO4S/c1-9(2)5-4-6-20-14(17)12-7-11(16)8-13(10(12)3)21(15,18)19/h7-9H,4-6H2,1-3H3 |
| InChIKey | OLWWYXODDBKLQP-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.81 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-methylpentyl 3-chlorosulfonyl-5-fluoro-2-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylpentyl 3-chlorosulfonyl-5-fluoro-2-methylbenzoate?
The IUPAC name of 4-methylpentyl 3-chlorosulfonyl-5-fluoro-2-methylbenzoate (CID 65373345) is 4-methylpentyl 3-chlorosulfonyl-5-fluoro-2-methylbenzoate.
What is the SMILES notation for 4-methylpentyl 3-chlorosulfonyl-5-fluoro-2-methylbenzoate?
The canonical SMILES for 4-methylpentyl 3-chlorosulfonyl-5-fluoro-2-methylbenzoate is Cc1c(C(=O)OCCCC(C)C)cc(F)cc1S(=O)(=O)Cl.
What is the InChIKey of 4-methylpentyl 3-chlorosulfonyl-5-fluoro-2-methylbenzoate?
The InChIKey is OLWWYXODDBKLQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18ClFO4S/c1-9(2)5-4-6-20-14(17)12-7-11(16)8-13(10(12)3)21(15,18)19/h7-9H,4-6H2,1-3H3.
What are the key properties of 4-methylpentyl 3-chlorosulfonyl-5-fluoro-2-methylbenzoate?
4-methylpentyl 3-chlorosulfonyl-5-fluoro-2-methylbenzoate has a molecular weight of 336.81 g/mol, XLogP of 3.65, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylpentyl 3-chlorosulfonyl-5-fluoro-2-methylbenzoate is sourced from PubChem (CID 65373345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).