C11H13BrFNO5S — CID 65382042
3-methoxypropyl 4-bromo-3-fluoro-5-sulfamoylbenzoate (PubChem CID 65382042) has the molecular formula C11H13BrFNO5S and a molecular weight of 370.20 g/mol. Its IUPAC name is 3-methoxypropyl 4-bromo-3-fluoro-5-sulfamoylbenzoate.
| Compound Name | 3-methoxypropyl 4-bromo-3-fluoro-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 65382042 |
| Molecular Formula | C11H13BrFNO5S |
| Molecular Weight | 370.20 g/mol |
| Exact Mass | 368.97 |
| IUPAC Name | 3-methoxypropyl 4-bromo-3-fluoro-5-sulfamoylbenzoate |
| SMILES | COCCCOC(=O)c1cc(F)c(Br)c(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C11H13BrFNO5S/c1-18-3-2-4-19-11(15)7-5-8(13)10(12)9(6-7)20(14,16)17/h5-6H,2-4H2,1H3,(H2,14,16,17) |
| InChIKey | JPNVXHLVTLZPAL-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.20 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|