C11H16N2O3S — CID 47109334
N-ethyl-3,4-dimethyl-5-sulfamoylbenzamide (PubChem CID 47109334) has the molecular formula C11H16N2O3S and a molecular weight of 256.33 g/mol. Its IUPAC name is N-ethyl-3,4-dimethyl-5-sulfamoylbenzamide.
| Compound Name | N-ethyl-3,4-dimethyl-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 47109334 |
| Molecular Formula | C11H16N2O3S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | N-ethyl-3,4-dimethyl-5-sulfamoylbenzamide |
| SMILES | CCNC(=O)c1cc(C)c(C)c(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C11H16N2O3S/c1-4-13-11(14)9-5-7(2)8(3)10(6-9)17(12,15)16/h5-6H,4H2,1-3H3,(H,13,14)(H2,12,15,16) |
| InChIKey | LYMSHALXVPIYDL-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |