C15H25N3O3S — CID 119608396
N-(1-amino-2,3-dimethylbutan-2-yl)-3,4-dimethyl-5-sulfamoylbenzamide (PubChem CID 119608396) has the molecular formula C15H25N3O3S and a molecular weight of 327.45 g/mol. Its IUPAC name is N-(1-amino-2,3-dimethylbutan-2-yl)-3,4-dimethyl-5-sulfamoylbenzamide.
| Compound Name | N-(1-amino-2,3-dimethylbutan-2-yl)-3,4-dimethyl-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 119608396 |
| Molecular Formula | C15H25N3O3S |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | N-(1-amino-2,3-dimethylbutan-2-yl)-3,4-dimethyl-5-sulfamoylbenzamide |
| SMILES | Cc1cc(C(=O)NC(C)(CN)C(C)C)cc(S(N)(=O)=O)c1C |
| InChI | InChI=1S/C15H25N3O3S/c1-9(2)15(5,8-16)18-14(19)12-6-10(3)11(4)13(7-12)22(17,20)21/h6-7,9H,8,16H2,1-5H3,(H,18,19)(H2,17,20,21) |
| InChIKey | SNUOZRSACHDXSZ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |