C15H24N2O3S — CID 115643625
3,4-dimethyl-N-(2-methylpentan-2-yl)-5-sulfamoylbenzamide (PubChem CID 115643625) has the molecular formula C15H24N2O3S and a molecular weight of 312.44 g/mol. Its IUPAC name is 3,4-dimethyl-N-(2-methylpentan-2-yl)-5-sulfamoylbenzamide.
| Compound Name | 3,4-dimethyl-N-(2-methylpentan-2-yl)-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 115643625 |
| Molecular Formula | C15H24N2O3S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 3,4-dimethyl-N-(2-methylpentan-2-yl)-5-sulfamoylbenzamide |
| SMILES | CCCC(C)(C)NC(=O)c1cc(C)c(C)c(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C15H24N2O3S/c1-6-7-15(4,5)17-14(18)12-8-10(2)11(3)13(9-12)21(16,19)20/h8-9H,6-7H2,1-5H3,(H,17,18)(H2,16,19,20) |
| InChIKey | RZXRQIJCWQYNHH-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |