C16H24N2O5S — CID 119227574
7-[(3,4-dimethyl-5-sulfamoylbenzoyl)amino]heptanoic acid (PubChem CID 119227574) has the molecular formula C16H24N2O5S and a molecular weight of 356.44 g/mol. Its IUPAC name is 7-[(3,4-dimethyl-5-sulfamoylbenzoyl)amino]heptanoic acid.
| Compound Name | 7-[(3,4-dimethyl-5-sulfamoylbenzoyl)amino]heptanoic acid |
|---|---|
| PubChem CID | 119227574 |
| Molecular Formula | C16H24N2O5S |
| Molecular Weight | 356.44 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 7-[(3,4-dimethyl-5-sulfamoylbenzoyl)amino]heptanoic acid |
| SMILES | Cc1cc(C(=O)NCCCCCCC(=O)O)cc(S(N)(=O)=O)c1C |
| InChI | InChI=1S/C16H24N2O5S/c1-11-9-13(10-14(12(11)2)24(17,22)23)16(21)18-8-6-4-3-5-7-15(19)20/h9-10H,3-8H2,1-2H3,(H,18,21)(H,19,20)(H2,17,22,23) |
| InChIKey | MUBGLUHZNMAKOR-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.44 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|