C14H20N2O5S — CID 119235149
5-[(3,4-dimethyl-5-sulfamoylbenzoyl)amino]pentanoic acid (PubChem CID 119235149) has the molecular formula C14H20N2O5S and a molecular weight of 328.39 g/mol. Its IUPAC name is 5-[(3,4-dimethyl-5-sulfamoylbenzoyl)amino]pentanoic acid.
| Compound Name | 5-[(3,4-dimethyl-5-sulfamoylbenzoyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 119235149 |
| Molecular Formula | C14H20N2O5S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 5-[(3,4-dimethyl-5-sulfamoylbenzoyl)amino]pentanoic acid |
| SMILES | Cc1cc(C(=O)NCCCCC(=O)O)cc(S(N)(=O)=O)c1C |
| InChI | InChI=1S/C14H20N2O5S/c1-9-7-11(8-12(10(9)2)22(15,20)21)14(19)16-6-4-3-5-13(17)18/h7-8H,3-6H2,1-2H3,(H,16,19)(H,17,18)(H2,15,20,21) |
| InChIKey | KRRCJAVPXPZIQN-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|