C17H25NO5S — CID 120524109
7-[(4-ethyl-3-methylsulfonylbenzoyl)amino]heptanoic acid (PubChem CID 120524109) has the molecular formula C17H25NO5S and a molecular weight of 355.46 g/mol. Its IUPAC name is 7-[(4-ethyl-3-methylsulfonylbenzoyl)amino]heptanoic acid.
| Compound Name | 7-[(4-ethyl-3-methylsulfonylbenzoyl)amino]heptanoic acid |
|---|---|
| PubChem CID | 120524109 |
| Molecular Formula | C17H25NO5S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 7-[(4-ethyl-3-methylsulfonylbenzoyl)amino]heptanoic acid |
| SMILES | CCc1ccc(C(=O)NCCCCCCC(=O)O)cc1S(C)(=O)=O |
| InChI | InChI=1S/C17H25NO5S/c1-3-13-9-10-14(12-15(13)24(2,22)23)17(21)18-11-7-5-4-6-8-16(19)20/h9-10,12H,3-8,11H2,1-2H3,(H,18,21)(H,19,20) |
| InChIKey | GLFVOHKNMUOIEX-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|