C14H21NO5S2 — CID 120689510
8-[(5-methylsulfonylthiophene-3-carbonyl)amino]octanoic acid (PubChem CID 120689510) has the molecular formula C14H21NO5S2 and a molecular weight of 347.46 g/mol. Its IUPAC name is 8-[(5-methylsulfonylthiophene-3-carbonyl)amino]octanoic acid.
| Compound Name | 8-[(5-methylsulfonylthiophene-3-carbonyl)amino]octanoic acid |
|---|---|
| PubChem CID | 120689510 |
| Molecular Formula | C14H21NO5S2 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 8-[(5-methylsulfonylthiophene-3-carbonyl)amino]octanoic acid |
| SMILES | CS(=O)(=O)c1cc(C(=O)NCCCCCCCC(=O)O)cs1 |
| InChI | InChI=1S/C14H21NO5S2/c1-22(19,20)13-9-11(10-21-13)14(18)15-8-6-4-2-3-5-7-12(16)17/h9-10H,2-8H2,1H3,(H,15,18)(H,16,17) |
| InChIKey | HOHCTRJJQDZLSC-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|