C16H17NO5S2 — CID 120686328
4-[(5-methylsulfonylthiophene-3-carbonyl)amino]-4-phenylbutanoic acid (PubChem CID 120686328) has the molecular formula C16H17NO5S2 and a molecular weight of 367.45 g/mol. Its IUPAC name is 4-[(5-methylsulfonylthiophene-3-carbonyl)amino]-4-phenylbutanoic acid.
| Compound Name | 4-[(5-methylsulfonylthiophene-3-carbonyl)amino]-4-phenylbutanoic acid |
|---|---|
| PubChem CID | 120686328 |
| Molecular Formula | C16H17NO5S2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.05 |
| IUPAC Name | 4-[(5-methylsulfonylthiophene-3-carbonyl)amino]-4-phenylbutanoic acid |
| SMILES | CS(=O)(=O)c1cc(C(=O)NC(CCC(=O)O)c2ccccc2)cs1 |
| InChI | InChI=1S/C16H17NO5S2/c1-24(21,22)15-9-12(10-23-15)16(20)17-13(7-8-14(18)19)11-5-3-2-4-6-11/h2-6,9-10,13H,7-8H2,1H3,(H,17,20)(H,18,19) |
| InChIKey | TYUILJUBRIJZFS-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |