C16H16BrNO4 — CID 119201012
4-[(5-bromo-3-methylfuran-2-carbonyl)amino]-4-phenylbutanoic acid (PubChem CID 119201012) has the molecular formula C16H16BrNO4 and a molecular weight of 366.21 g/mol. Its IUPAC name is 4-[(5-bromo-3-methylfuran-2-carbonyl)amino]-4-phenylbutanoic acid.
| Compound Name | 4-[(5-bromo-3-methylfuran-2-carbonyl)amino]-4-phenylbutanoic acid |
|---|---|
| PubChem CID | 119201012 |
| Molecular Formula | C16H16BrNO4 |
| Molecular Weight | 366.21 g/mol |
| Exact Mass | 365.03 |
| IUPAC Name | 4-[(5-bromo-3-methylfuran-2-carbonyl)amino]-4-phenylbutanoic acid |
| SMILES | Cc1cc(Br)oc1C(=O)NC(CCC(=O)O)c1ccccc1 |
| InChI | InChI=1S/C16H16BrNO4/c1-10-9-13(17)22-15(10)16(21)18-12(7-8-14(19)20)11-5-3-2-4-6-11/h2-6,9,12H,7-8H2,1H3,(H,18,21)(H,19,20) |
| InChIKey | FBGFEKOLKVCHGL-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.21 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |