C19H16ClNO4 — CID 75383586
4-[(5-chloro-1-benzofuran-2-carbonyl)amino]-4-phenylbutanoic acid (PubChem CID 75383586) has the molecular formula C19H16ClNO4 and a molecular weight of 357.79 g/mol. Its IUPAC name is 4-[(5-chloro-1-benzofuran-2-carbonyl)amino]-4-phenylbutanoic acid.
| Compound Name | 4-[(5-chloro-1-benzofuran-2-carbonyl)amino]-4-phenylbutanoic acid |
|---|---|
| PubChem CID | 75383586 |
| Molecular Formula | C19H16ClNO4 |
| Molecular Weight | 357.79 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | 4-[(5-chloro-1-benzofuran-2-carbonyl)amino]-4-phenylbutanoic acid |
| SMILES | O=C(O)CCC(NC(=O)c1cc2cc(Cl)ccc2o1)c1ccccc1 |
| InChI | InChI=1S/C19H16ClNO4/c20-14-6-8-16-13(10-14)11-17(25-16)19(24)21-15(7-9-18(22)23)12-4-2-1-3-5-12/h1-6,8,10-11,15H,7,9H2,(H,21,24)(H,22,23) |
| InChIKey | HLOZYFSMVWRTKI-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.79 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |