C15H16ClNO4 — CID 86813424
ethyl 3-[(5-chloro-1-benzofuran-2-carbonyl)amino]butanoate (PubChem CID 86813424) has the molecular formula C15H16ClNO4 and a molecular weight of 309.75 g/mol. Its IUPAC name is ethyl 3-[(5-chloro-1-benzofuran-2-carbonyl)amino]butanoate.
| Compound Name | ethyl 3-[(5-chloro-1-benzofuran-2-carbonyl)amino]butanoate |
|---|---|
| PubChem CID | 86813424 |
| Molecular Formula | C15H16ClNO4 |
| Molecular Weight | 309.75 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | ethyl 3-[(5-chloro-1-benzofuran-2-carbonyl)amino]butanoate |
| SMILES | CCOC(=O)CC(C)NC(=O)c1cc2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C15H16ClNO4/c1-3-20-14(18)6-9(2)17-15(19)13-8-10-7-11(16)4-5-12(10)21-13/h4-5,7-9H,3,6H2,1-2H3,(H,17,19) |
| InChIKey | UVBVBINSYNBQAX-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.75 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |