C14H16ClNO2 — CID 114736502
1-(5-chloro-1-benzofuran-2-yl)-3-(ethylamino)butan-1-one (PubChem CID 114736502) has the molecular formula C14H16ClNO2 and a molecular weight of 265.74 g/mol. Its IUPAC name is 1-(5-chloro-1-benzofuran-2-yl)-3-(ethylamino)butan-1-one.
| Compound Name | 1-(5-chloro-1-benzofuran-2-yl)-3-(ethylamino)butan-1-one |
|---|---|
| PubChem CID | 114736502 |
| Molecular Formula | C14H16ClNO2 |
| Molecular Weight | 265.74 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 1-(5-chloro-1-benzofuran-2-yl)-3-(ethylamino)butan-1-one |
| SMILES | CCNC(C)CC(=O)c1cc2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C14H16ClNO2/c1-3-16-9(2)6-12(17)14-8-10-7-11(15)4-5-13(10)18-14/h4-5,7-9,16H,3,6H2,1-2H3 |
| InChIKey | YPBAGXNVIYGYRF-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.74 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |