C15H8ClF2NO2 — CID 51217226
5-chloro-N-(2,6-difluorophenyl)-1-benzofuran-2-carboxamide (PubChem CID 51217226) has the molecular formula C15H8ClF2NO2 and a molecular weight of 307.68 g/mol. Its IUPAC name is 5-chloro-N-(2,6-difluorophenyl)-1-benzofuran-2-carboxamide.
| Compound Name | 5-chloro-N-(2,6-difluorophenyl)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 51217226 |
| Molecular Formula | C15H8ClF2NO2 |
| Molecular Weight | 307.68 g/mol |
| Exact Mass | 307.02 |
| IUPAC Name | 5-chloro-N-(2,6-difluorophenyl)-1-benzofuran-2-carboxamide |
| SMILES | O=C(Nc1c(F)cccc1F)c1cc2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C15H8ClF2NO2/c16-9-4-5-12-8(6-9)7-13(21-12)15(20)19-14-10(17)2-1-3-11(14)18/h1-7H,(H,19,20) |
| InChIKey | PETQMTONGORTQZ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.68 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |