C17H14ClNO2 — CID 38294036
5-chloro-N-[(3-methylphenyl)methyl]-1-benzofuran-2-carboxamide (PubChem CID 38294036) has the molecular formula C17H14ClNO2 and a molecular weight of 299.76 g/mol. Its IUPAC name is 5-chloro-N-[(3-methylphenyl)methyl]-1-benzofuran-2-carboxamide.
| Compound Name | 5-chloro-N-[(3-methylphenyl)methyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 38294036 |
| Molecular Formula | C17H14ClNO2 |
| Molecular Weight | 299.76 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | 5-chloro-N-[(3-methylphenyl)methyl]-1-benzofuran-2-carboxamide |
| SMILES | Cc1cccc(CNC(=O)c2cc3cc(Cl)ccc3o2)c1 |
| InChI | InChI=1S/C17H14ClNO2/c1-11-3-2-4-12(7-11)10-19-17(20)16-9-13-8-14(18)5-6-15(13)21-16/h2-9H,10H2,1H3,(H,19,20) |
| InChIKey | JIICWWNSKBBTRU-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.76 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |