C16H14N2O2 — CID 61089712
5-amino-N-benzyl-1-benzofuran-2-carboxamide (PubChem CID 61089712) has the molecular formula C16H14N2O2 and a molecular weight of 266.30 g/mol. Its IUPAC name is 5-amino-N-benzyl-1-benzofuran-2-carboxamide.
| Compound Name | 5-amino-N-benzyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 61089712 |
| Molecular Formula | C16H14N2O2 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 5-amino-N-benzyl-1-benzofuran-2-carboxamide |
| SMILES | Nc1ccc2oc(C(=O)NCc3ccccc3)cc2c1 |
| InChI | InChI=1S/C16H14N2O2/c17-13-6-7-14-12(8-13)9-15(20-14)16(19)18-10-11-4-2-1-3-5-11/h1-9H,10,17H2,(H,18,19) |
| InChIKey | BZERUHNNXZMYIK-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|