C18H15NO3 — CID 20677387
N-[(4-acetylphenyl)methyl]-1-benzofuran-2-carboxamide (PubChem CID 20677387) has the molecular formula C18H15NO3 and a molecular weight of 293.32 g/mol. Its IUPAC name is N-[(4-acetylphenyl)methyl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[(4-acetylphenyl)methyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 20677387 |
| Molecular Formula | C18H15NO3 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | N-[(4-acetylphenyl)methyl]-1-benzofuran-2-carboxamide |
| SMILES | CC(=O)c1ccc(CNC(=O)c2cc3ccccc3o2)cc1 |
| InChI | InChI=1S/C18H15NO3/c1-12(20)14-8-6-13(7-9-14)11-19-18(21)17-10-15-4-2-3-5-16(15)22-17/h2-10H,11H2,1H3,(H,19,21) |
| InChIKey | MMDXGVYRWBJPSR-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |