C24H23N3O6S — CID 71476314
N-[[4-[(2-aminophenyl)carbamoyl]phenyl]methyl]-1-benzofuran-2-carboxamide;methanesulfonic acid (PubChem CID 71476314) has the molecular formula C24H23N3O6S and a molecular weight of 481.53 g/mol. Its IUPAC name is N-[[4-[(2-aminophenyl)carbamoyl]phenyl]methyl]-1-benzofuran-2-carboxamide;methanesulfonic acid.
| Compound Name | N-[[4-[(2-aminophenyl)carbamoyl]phenyl]methyl]-1-benzofuran-2-carboxamide;methanesulfonic acid |
|---|---|
| PubChem CID | 71476314 |
| Molecular Formula | C24H23N3O6S |
| Molecular Weight | 481.53 g/mol |
| Exact Mass | 481.13 |
| IUPAC Name | N-[[4-[(2-aminophenyl)carbamoyl]phenyl]methyl]-1-benzofuran-2-carboxamide;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.Nc1ccccc1NC(=O)c1ccc(CNC(=O)c2cc3ccccc3o2)cc1 |
| InChI | InChI=1S/C23H19N3O3.CH4O3S/c24-18-6-2-3-7-19(18)26-22(27)16-11-9-15(10-12-16)14-25-23(28)21-13-17-5-1-4-8-20(17)29-21;1-5(2,3)4/h1-13H,14,24H2,(H,25,28)(H,26,27);1H3,(H,2,3,4) |
| InChIKey | HYLKABWCASBDRF-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 151.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.53 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|